|
CAS#: 900802-72-4 Product: 1-[3-(2-Methyl-2-propanyl)phenyl]cyclopropanamine No suppilers available for the product. |
| Name | 1-[3-(2-Methyl-2-propanyl)phenyl]cyclopropanamine |
|---|---|
| Synonyms | Cyclopropanamine, 1-[3-(1,1-dimethylethyl)phenyl]-; Cyclopropanamine,1-[3-(1,1-dimethylethyl)phenyl]- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 |
| CAS Registry Number | 900802-72-4 |
| SMILES | CC(C)(C)c1cccc(c1)C2(CC2)N |
| InChI | 1S/C13H19N/c1-12(2,3)10-5-4-6-11(9-10)13(14)7-8-13/h4-6,9H,7-8,14H2,1-3H3 |
| InChIKey | CEPJQAFVPMIAJG-UHFFFAOYSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.657°C at 760 mmHg (Cal.) |
| Flash point | 102.06°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(2-Methyl-2-propanyl)phenyl]cyclopropanamine |