Online Database of Chemicals from Around the World
|
CAS#: 90358-65-9 Product: Ferene triazine No suppilers available for the product. |
| Name | Ferene triazine |
|---|---|
| Synonyms | 5,6-Bis(2-Furyl)-3-(2-Pyridyl)-1,2,4-Triazine; 1,2,4-Triazine, 5,6-Di-2-Furanyl-3-(2-Pyridinyl)-; 3-(2-Pyridyl)-5,6-Bis(2-Furyl)-1,2,4-Triazine |
| Molecular Structure |  |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 |
| CAS Registry Number | 90358-65-9 |
| SMILES | C4=C(C1=C(N=NC(=N1)C2=NC=CC=C2)C3=CC=CO3)OC=C4 |
| InChI | 1S/C16H10N4O2/c1-2-8-17-11(5-1)16-18-14(12-6-3-9-21-12)15(19-20-16)13-7-4-10-22-13/h1-10H |
| InChIKey | ILGVLLHYNIYCAR-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.583°C at 760 mmHg (Cal.) |
| Flash point | 248.318°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ferene triazine |