Online Database of Chemicals from Around the World
|
CAS#: 905302-18-3 Product: 4-Bromo-2-nitro-1-naphthol No suppilers available for the product. |
| Name | 4-Bromo-2-nitro-1-naphthol |
|---|---|
| Synonyms | 4-Bromo-2-nitro-1-naphthalenol |
| Molecular Formula | C10H6BrNO3 |
| Molecular Weight | 268.06 |
| CAS Registry Number | 905302-18-3 |
| SMILES | [O-][N+](=O)c2c(O)c1ccccc1c(Br)c2 |
| InChI | 1S/C10H6BrNO3/c11-8-5-9(12(14)15)10(13)7-4-2-1-3-6(7)8/h1-5,13H |
| InChIKey | RYGNNSNXVBBMSK-UHFFFAOYSA-N |
| Density | 1.787g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.463°C at 760 mmHg (Cal.) |
| Flash point | 178.454°C (Cal.) |
| Refractive index | 1.735 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2-nitro-1-naphthol |