|
CAS#: 90697-56-6 Product: Zimidoben No suppilers available for the product. |
| Name | Zimidoben |
|---|---|
| Synonyms | Benzoic Acid 2-(1-Imidazolyl)Ethyl Ester; Benzoic Acid 2-Imidazol-1-Ylethyl Ester; 2-(1-Imidaozlyl)Ethyl Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 90697-56-6 |
| SMILES | C2=C(C(OCC[N]1C=CN=C1)=O)C=CC=C2 |
| InChI | 1S/C12H12N2O2/c15-12(11-4-2-1-3-5-11)16-9-8-14-7-6-13-10-14/h1-7,10H,8-9H2 |
| InChIKey | DPTKNRPHFRFPCX-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.773°C at 760 mmHg (Cal.) |
| Flash point | 200.414°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zimidoben |