Online Database of Chemicals from Around the World
|
CAS#: 91658-68-3 Product: 2,3,7-Phenazinetriamine No suppilers available for the product. |
| Name | 2,3,7-Phenazinetriamine |
|---|---|
| Synonyms | 2,3,7-Phenazinetriamine |
| Molecular Structure |  |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 |
| CAS Registry Number | 91658-68-3 |
| SMILES | c1cc2c(cc1N)nc3cc(c(cc3n2)N)N |
| InChI | 1S/C12H11N5/c13-6-1-2-9-10(3-6)17-12-5-8(15)7(14)4-11(12)16-9/h1-5H,13-15H2 |
| InChIKey | NPSHKYRLDHUWLW-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 580.624°C at 760 mmHg (Cal.) |
| Flash point | 340.073°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,7-Phenazinetriamine |