Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,4-Phenazinediamine |
|---|---|
| Synonyms | phenazine-1,4-diamine |
| Molecular Structure |  |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 91974-60-6 |
| SMILES | c1ccc2c(c1)nc3c(ccc(c3n2)N)N |
| InChI | 1S/C12H10N4/c13-7-5-6-8(14)12-11(7)15-9-3-1-2-4-10(9)16-12/h1-6H,13-14H2 |
| InChIKey | HZROQHQHUDWHFG-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.849°C at 760 mmHg (Cal.) |
| Flash point | 286.464°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Phenazinediamine |