Online Database of Chemicals from Around the World
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (831) 457-3800 | |||
 |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 3-(2H9)Phenanthrenol |
|---|---|
| Synonyms | 3-Phenanthrol-d9 |
| Molecular Structure |  |
| Molecular Formula | C14HD9O |
| Molecular Weight | 203.28 |
| CAS Registry Number | 922510-20-1 |
| SMILES | [2H]c1c(c(c2c(c1[2H])c(c(c3c2c(c(c(c3[2H])[2H])O)[2H])[2H])[2H])[2H])[2H] |
| InChI | 1S/C14H10O/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9,15H/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
| InChIKey | NGPOABOEXMDQBT-LOIXRAQWSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.508°C at 760 mmHg (Cal.) |
| Flash point | 197.72°C (Cal.) |
| Refractive index | 1.754 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2H9)Phenanthrenol |