Online Database of Chemicals from Around the World
|
CAS#: 931-98-6 Product: 1-Iodobicyclo[2.2.2]octane No suppilers available for the product. |
| Name | 1-Iodobicyclo[2.2.2]octane |
|---|---|
| Synonyms | Bicyclo(2.2.2)Octane, 1-Iodo-; Inchi=1/C8h13i/C9-8-4-1-7(2-5-8)3-6-8/H7h,1-6H; Bicyclo[2.2.2]Octane, 1-Iodo- |
| Molecular Structure | ![CAS#: 931-98-6， 1-Iodobicyclo[2.2.2]octane](/moreStructures/931-98-6.gif) |
| Molecular Formula | C8H13I |
| Molecular Weight | 236.10 |
| CAS Registry Number | 931-98-6 |
| SMILES | C1C2(I)CCC(C1)CC2 |
| InChI | 1S/C8H13I/c9-8-4-1-7(2-5-8)3-6-8/h7H,1-6H2 |
| InChIKey | SMDJHIPXLFNPTJ-UHFFFAOYSA-N |
| Density | 1.635g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.273°C at 760 mmHg (Cal.) |
| Flash point | 93.789°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Iodobicyclo[2.2.2]octane |