Online Database of Chemicals from Around the World
|
CAS#: 93452-23-4 Product: Allamcin No suppilers available for the product. |
| Name | Allamcin |
|---|---|
| Synonyms | 2H,6H-1,4,5-Trioxadicyclopenta(A,Hi)Inden-2-One, 3-Ethylidene-3,3A,4A,7,7A,9B-Hexahydro-6-Hydroxy-, (3E,3Aalpha,4Abeta,6Beta,7Abeta,9Ar*,9Bbeta)-(+)-; Allamcin |
| Molecular Structure |  |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 |
| CAS Registry Number | 93452-23-4 |
| SMILES | C\C=C/3C2OC1OC(O)CC4C1C2(OC3=O)C=C4 |
| InChI | 1S/C13H14O5/c1-2-7-10-13(18-11(7)15)4-3-6-5-8(14)16-12(17-10)9(6)13/h2-4,6,8-10,12,14H,5H2,1H3/b7-2- |
| InChIKey | DWWKELQVGKIHDR-UQCOIBPSSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.281°C at 760 mmHg (Cal.) |
| Flash point | 198.824°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allamcin |