Online Database of Chemicals from Around the World
|
CAS#: 93803-58-8 Product: 2,2'-Methylenebis(6-cyclopentyl-4-isopropylphenol) No suppilers available for the product. |
| Name | 2,2'-Methylenebis(6-cyclopentyl-4-isopropylphenol) |
|---|---|
| Synonyms | 2,2'-methylenebis[6-cyclopentyl-4-isopropylphenol] |
| Molecular Structure |  |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.63 |
| CAS Registry Number | 93803-58-8 |
| EINECS | 298-330-5 |
| SMILES | CC(C)c3cc(Cc1cc(cc(c1O)C2CCCC2)C(C)C)c(O)c(c3)C4CCCC4 |
| InChI | 1S/C29H40O2/c1-18(2)22-13-24(28(30)26(16-22)20-9-5-6-10-20)15-25-14-23(19(3)4)17-27(29(25)31)21-11-7-8-12-21/h13-14,16-21,30-31H,5-12,15H2,1-4H3 |
| InChIKey | LFKIOZVKIKEHNB-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.533°C at 760 mmHg (Cal.) |
| Flash point | 193.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Methylenebis(6-cyclopentyl-4-isopropylphenol) |