Online Database of Chemicals from Around the World
|
CAS#: 93892-44-5 Product: 4,4'-Methylenebis(6-cyclopentyl-3,3-dimethyl-5-indanol) No suppilers available for the product. |
| Name | 4,4'-Methylenebis(6-cyclopentyl-3,3-dimethyl-5-indanol) |
|---|---|
| Synonyms | 4,4'-methylenebis[6-cyclopentyl-3,3-dimethylindan-5-ol] |
| Molecular Structure |  |
| Molecular Formula | C33H44O2 |
| Molecular Weight | 472.70 |
| CAS Registry Number | 93892-44-5 |
| EINECS | 299-527-9 |
| SMILES | CC6(C)CCc5cc(C1CCCC1)c(O)c(Cc2c(O)c(cc3CCC(C)(C)c23)C4CCCC4)c56 |
| InChI | 1S/C33H44O2/c1-32(2)15-13-22-17-24(20-9-5-6-10-20)30(34)26(28(22)32)19-27-29-23(14-16-33(29,3)4)18-25(31(27)35)21-11-7-8-12-21/h17-18,20-21,34-35H,5-16,19H2,1-4H3 |
| InChIKey | BFMRXSZZYNJRHW-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.826°C at 760 mmHg (Cal.) |
| Flash point | 211.411°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Methylenebis(6-cyclopentyl-3,3-dimethyl-5-indanol) |