Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | 3-Chloro-2-Hydroxy-Benzoyl Chloride |
|---|---|
| Synonyms | 3-Chloro-2-Hydroxy-Benzoyl Chloride |
| Molecular Structure |  |
| Molecular Formula | C7H4Cl2O2 |
| Molecular Weight | 191.01 |
| CAS Registry Number | 93820-08-7 |
| EINECS | 298-593-6 |
| SMILES | C1=C(Cl)C(=C(C(Cl)=O)C=C1)O |
| InChI | 1S/C7H4Cl2O2/c8-5-3-1-2-4(6(5)10)7(9)11/h1-3,10H |
| InChIKey | WYNNSVYZZSTMJA-UHFFFAOYSA-N |
| Density | 1.513g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.605°C at 760 mmHg (Cal.) |
| Flash point | 108.991°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2-Hydroxy-Benzoyl Chloride |