Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Chloro-5-hydroxy-1,4-benzoquinone |
|---|---|
| Synonyms | 2-chloro-5-hydroxycyclohexa-2,5-diene-1,4-dione |
| Molecular Structure |  |
| Molecular Formula | C6H3ClO3 |
| Molecular Weight | 158.54 |
| CAS Registry Number | 89284-69-5 |
| SMILES | O=C1\C=C(\Cl)C(=O)/C=C1/O |
| InChI | 1S/C6H3ClO3/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H |
| InChIKey | QDGSLISDGXAGPR-UHFFFAOYSA-N |
| Density | 1.599g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.464°C at 760 mmHg (Cal.) |
| Flash point | 121.001°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-5-hydroxy-1,4-benzoquinone |