Online Database of Chemicals from Around the World
|
CAS#: 93963-35-0 Product: 4-(4-Cumenyl)-4-Methylpentan-2-Ol No suppilers available for the product. |
| Name | 4-(4-Cumenyl)-4-Methylpentan-2-Ol |
|---|---|
| Synonyms | 4-(4-Isopropylphenyl)-4-Methyl-Pentan-2-Ol; 4-(4-Isopropylphenyl)-4-Methylpentan-2-Ol; 4-(P-Cumenyl)-4-Methylpentan-2-Ol |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 93963-35-0 |
| EINECS | 300-777-9 |
| SMILES | C1=C(C(CC(O)C)(C)C)C=CC(=C1)C(C)C |
| InChI | 1S/C15H24O/c1-11(2)13-6-8-14(9-7-13)15(4,5)10-12(3)16/h6-9,11-12,16H,10H2,1-5H3 |
| InChIKey | FBICAHFVMKPFJF-UHFFFAOYSA-N |
| Density | 0.929g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.067°C at 760 mmHg (Cal.) |
| Flash point | 114.633°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Cumenyl)-4-Methylpentan-2-Ol |