Online Database of Chemicals from Around the World
|
CAS#: 42571-81-3 Product: o-Cumenyl Chloroformate No suppilers available for the product. |
| Name | o-Cumenyl Chloroformate |
|---|---|
| Synonyms | (2-Isopropylphenyl) Chloroformate; Chloroformic Acid (2-Isopropylphenyl) Ester; (2-Propan-2-Ylphenyl) Chloromethanoate |
| Molecular Structure |  |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 |
| CAS Registry Number | 42571-81-3 |
| EINECS | 255-888-4 |
| SMILES | C1=CC=CC(=C1OC(Cl)=O)C(C)C |
| InChI | 1S/C10H11ClO2/c1-7(2)8-5-3-4-6-9(8)13-10(11)12/h3-7H,1-2H3 |
| InChIKey | PACHGVCDFBIVDA-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.634°C at 760 mmHg (Cal.) |
| Flash point | 91.995°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for o-Cumenyl Chloroformate |