Online Database of Chemicals from Around the World
|
CAS#: 93982-33-3 Product: Ammonium Pentyl Sulphate No suppilers available for the product. |
| Name | Ammonium Pentyl Sulphate |
|---|---|
| Synonyms | Ammonium Pentyl Sulfate; Ammonium Amyl Sulfate; Ammonium Pentyl Sulphate |
| Molecular Structure |  |
| Molecular Formula | C5H15NO4S |
| Molecular Weight | 185.24 |
| CAS Registry Number | 93982-33-3 |
| EINECS | 301-222-3 |
| SMILES | C(CCO[S]([O-])(=O)=O)CC.[NH4+] |
| InChI | 1S/C5H12O4S.H3N/c1-2-3-4-5-9-10(6,7)8;/h2-5H2,1H3,(H,6,7,8);1H3 |
| InChIKey | MGHQUGUIYCOZKR-UHFFFAOYSA-N |
| Boiling point | 326.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 151°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium Pentyl Sulphate |