Online Database of Chemicals from Around the World
|
CAS#: 94099-66-8 Product: Purpurin-1-Methyl Ether No suppilers available for the product. |
| Name | Purpurin-1-Methyl Ether |
|---|---|
| Synonyms | 2,4-Dihydroxy-1-Methoxy-Anthracene-9,10-Dione; 2,4-Dihydroxy-1-Methoxy-9,10-Anthraquinone; C10397 |
| Molecular Structure |  |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 94099-66-8 |
| SMILES | C3=C(C2=C(C(=O)C1=CC=CC=C1C2=O)C(=C3O)OC)O |
| InChI | 1S/C15H10O5/c1-20-15-10(17)6-9(16)11-12(15)14(19)8-5-3-2-4-7(8)13(11)18/h2-6,16-17H,1H3 |
| InChIKey | NLORVHQRZMJFEZ-UHFFFAOYSA-N |
| Density | 1.502g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.17°C at 760 mmHg (Cal.) |
| Flash point | 207.991°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Purpurin-1-Methyl Ether |