Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | N-Ethyl-9-Acridinamine |
|---|---|
| Synonyms | N-Ethyl-9-Acridinamine; Acridin-9-Yl-Ethyl-Amine; 9-Acridinamine, N-Ethyl- |
| Molecular Structure |  |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 |
| CAS Registry Number | 94129-62-1 |
| SMILES | C2=C1C(=C3C(=NC1=CC=C2)C=CC=C3)NCC |
| InChI | 1S/C15H14N2/c1-2-16-15-11-7-3-5-9-13(11)17-14-10-6-4-8-12(14)15/h3-10H,2H2,1H3,(H,16,17) |
| InChIKey | PCZCQGXXFIYLRJ-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.556°C at 760 mmHg (Cal.) |
| Flash point | 199.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-9-Acridinamine |