Online Database of Chemicals from Around the World
|
CAS#: 94201-54-4 Product: sodium 5-ethyl-5-methyl-4,6-dioxo-1H-pyrimidin-2-olate No suppilers available for the product. |
| Name | sodium 5-ethyl-5-methyl-4,6-dioxo-1H-pyrimidin-2-olate |
|---|---|
| Synonyms | sodium 5-ethyl-5-methylbarbiturate |
| Molecular Structure |  |
| Molecular Formula | C7H9N2NaO3 |
| Molecular Weight | 192.15 |
| CAS Registry Number | 94201-54-4 |
| EINECS | 303-641-7 |
| SMILES | [Na+].O=C1N=C([O-])NC(=O)C1(C)CC |
| InChI | 1S/C7H10N2O3.Na/c1-3-7(2)4(10)8-6(12)9-5(7)11;/h3H2,1-2H3,(H2,8,9,10,11,12);/q;+1/p-1 |
| InChIKey | JGVGJDZXMRDAAD-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for sodium 5-ethyl-5-methyl-4,6-dioxo-1H-pyrimidin-2-olate |