Online Database of Chemicals from Around the World
|
CAS#: 94237-06-6 Product: (chloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-trimethylsilyloxy-silyl)oxy-trimethyl-silane No suppilers available for the product. |
| Name | (chloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-trimethylsilyloxy-silyl)oxy-trimethyl-silane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H22ClF13O2Si3 |
| Molecular Weight | 589.01 |
| CAS Registry Number | 94237-06-6 |
| EINECS | 304-105-5 |
| SMILES | Cl[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | 1S/C14H22ClF13O2Si3/c1-31(2,3)29-33(15,30-32(4,5)6)8-7-9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)28/h7-8H2,1-6H3 |
| InChIKey | YFBVNTASMGOUJT-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.897°C at 760 mmHg (Cal.) |
| Flash point | 135.778°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (chloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-trimethylsilyloxy-silyl)oxy-trimethyl-silane |