| Shanghai Worldyang Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.worldyachem.com | |||
![]() | +86 13651600618 +86 (21) 5679-5779 | |||
![]() | +86 (21) 5679-5266 | |||
![]() | sales7777@worldyachem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13651600618 | |||
![]() | WhatsApp:+86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Ketones |
|---|---|
| Name | 6-Chloro-7-fluoroindoline-2,3-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3ClFNO2 |
| Molecular Weight | 199.57 |
| CAS Registry Number | 942493-23-4 |
| EC Number | 983-091-8 |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)F)Cl |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319-H335 Details |
| Safety Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| SDS | Available |
|
6-Chloro-7-fluoroindole-2,3-dione is a synthetic chemical compound with great potential in medicinal chemistry and materials science. The development of 6-chloro-7-fluoroindole-2,3-dione stems from the efforts to explore indole derivatives with enhanced biological activity and functional properties. Researchers focus on modifying the indole-dione skeleton to optimize its pharmacological and chemical properties. The introduction of chlorine and fluorine atoms aims to improve its solubility, stability and interaction with biological targets, paving the way for potential therapeutic uses. The indole-dione core provides stability and serves as a scaffold for functionalization and derivatization. Chlorine and fluorine substitution enhances the chemical reactivity and bioactive characteristics of the compound, affecting its pharmacokinetics and pharmacodynamics. 6-Chloro-7-fluoroindole-2,3-dione exhibits promising anticancer properties by inhibiting key enzymes or pathways involved in tumor growth and metastasis. It may induce apoptosis (programmed cell death) in cancer cells and inhibit their proliferation, making it a candidate for the development of targeted anticancer therapies. The structure of the compound suggests that it has potential antibacterial effects against bacteria and fungi. It may damage microbial cell membranes or interfere with essential metabolic processes and is used to combat infectious diseases. 6-Chloro-7-fluoroindole-2,3-dione is used as a building block in organic synthesis to construct complex molecules and functional materials. Its fluorine and chlorine substitutions promote specific chemical reactions, such as nucleophilic substitutions and aromatic substitutions, enabling the synthesis of various chemical entities. The incorporation of 6-chloro-7-fluoroindole-2,3-dione into polymers and materials can modify their physical and chemical properties, enhancing their performance in various industrial applications, including coatings and adhesives. 6-Chloro-7-fluoroindole-2,3-dione can serve as a starting point for the design of new drugs with higher efficacy and fewer side effects. Structural modifications and derivatizations can optimize the pharmacological properties of the compound and enhance its therapeutic potential in treating specific diseases. It is used as a molecular probe in biochemical and cellular studies to study biological pathways and protein interactions. Its fluorinated and chlorinated structures have unique spectral properties that aid in bioimaging and diagnosis. References 2024. An improved synthetic process for ATX inhibitor Cudetaxestat (PAT-409). Chemical Papers, 78(11). DOI: 10.1007/s11696-024-03862-z |
| Market Analysis Reports |