| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Pharmaceutical intermediate >> API intermediate |
|---|---|
| Name | Axitinib Impurity B |
| Synonyms | 2-(1H-Indazol-6-ylthio)-N-methyl-benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.35 |
| CAS Registry Number | 944835-85-2 |
| SMILES | CNC(=O)C1=CC=CC=C1SC2=CC3=C(C=C2)C=NN3 |
| Solubility | 69.65 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.717, Calc.* |
| Melting point | 227.63 °C |
| Boiling Point | 532.18 °C, 555.7±30.0 °C (760 mmHg), Calc.* |
| Flash Point | 289.9±24.6 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H320-H335 Details |
| Safety Statements | P261-P302+P352-P280-P305 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Axitinib Impurity B |