|
CAS#: 947534-37-4 Product: 5-Bromo-1-(2,2-difluoroethoxy)-2,3-difluorobenzene No suppilers available for the product. |
| Name | 5-Bromo-1-(2,2-difluoroethoxy)-2,3-difluorobenzene |
|---|---|
| Synonyms | 5-Bromo-1-(2,2-difluoro-ethoxy)-2,3-difluoro-benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5BrF4O |
| Molecular Weight | 273.02 |
| CAS Registry Number | 947534-37-4 |
| SMILES | c1c(cc(c(c1OCC(F)F)F)F)Br |
| InChI | 1S/C8H5BrF4O/c9-4-1-5(10)8(13)6(2-4)14-3-7(11)12/h1-2,7H,3H2 |
| InChIKey | GOMLZMRDYIKXMR-UHFFFAOYSA-N |
| Density | 1.646g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.476°C at 760 mmHg (Cal.) |
| Flash point | 110.506°C (Cal.) |
| Refractive index | 1.461 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-1-(2,2-difluoroethoxy)-2,3-difluorobenzene |