Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Nitro-4-vinyl-1H-imidazole |
|---|---|
| Synonyms | 1H-Imidazole, 5-ethenyl-2-nitro-; 2-Nitro-4-vinyl-1H-imidazol; 2-Nitro-4-vinyl-1H-imidazole |
| Molecular Structure |  |
| Molecular Formula | C5H5N3O2 |
| Molecular Weight | 139.11 |
| CAS Registry Number | 948905-72-4 |
| SMILES | C=Cc1cnc([nH]1)[N+](=O)[O-] |
| InChI | 1S/C5H5N3O2/c1-2-4-3-6-5(7-4)8(9)10/h2-3H,1H2,(H,6,7) |
| InChIKey | SPZUWDOVYIUQOF-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.5±35.0°C at 760 mmHg (Cal.) |
| Flash point | 186.4±25.9°C (Cal.) |
| Refractive index | 1.655 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-4-vinyl-1H-imidazole |