Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-[4-(Trimethylsilyl)phenyl]methanimine |
|---|---|
| Synonyms | N-methylene-4-(trimethylsilyl)aniline; N-Methylene-4-(trimethylsilyl)aniline # |
| Molecular Structure | ![CAS#: 959293-19-7， N-[4-(Trimethylsilyl)phenyl]methanimine](/moreStructures/959293-19-7.gif) |
| Molecular Formula | C10H15NSi |
| Molecular Weight | 177.32 |
| CAS Registry Number | 959293-19-7 |
| SMILES | N(/c1ccc(cc1)[Si](C)(C)C)=C |
| InChI | 1S/C10H15NSi/c1-11-9-5-7-10(8-6-9)12(2,3)4/h5-8H,1H2,2-4H3 |
| InChIKey | ZTRZFDHKRUGFDT-UHFFFAOYSA-N |
| Density | 0.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 241.164°C at 760 mmHg (Cal.) |
| Flash point | 99.653°C (Cal.) |
| Refractive index | 1.472 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(Trimethylsilyl)phenyl]methanimine |