Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,4-Di(2-pentanyl)phenol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 |
| CAS Registry Number | 96-94-6 |
| SMILES | Oc1ccc(cc1C(CCC)C)C(C)CCC |
| InChI | 1S/C16H26O/c1-5-7-12(3)14-9-10-16(17)15(11-14)13(4)8-6-2/h9-13,17H,5-8H2,1-4H3 |
| InChIKey | QEVQVYGCTVKSER-UHFFFAOYSA-N |
| Density | 0.923g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.403°C at 760 mmHg (Cal.) |
| Flash point | 147.202°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Di(2-pentanyl)phenol |