Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Fluoro-1-adamantanecarbonyl fluoride |
|---|---|
| Synonyms | 3-fluoroadamantane-1-carbonyl fluoride |
| Molecular Structure |  |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 |
| CAS Registry Number | 96962-78-6 |
| SMILES | C1C2CC3(CC1CC(C2)(C3)F)C(=O)F |
| InChI | 1S/C11H14F2O/c12-9(14)10-2-7-1-8(3-10)5-11(13,4-7)6-10/h7-8H,1-6H2 |
| InChIKey | XMILERYZFDVABZ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.3±19.0°C at 760 mmHg (Cal.) |
| Flash point | 94.0±15.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Fluoro-1-adamantanecarbonyl fluoride |