Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,1-Dinitro-2-butanamine |
|---|---|
| Synonyms | 1,1-dinitrobutan-2-amine |
| Molecular Structure |  |
| Molecular Formula | C4H9N3O4 |
| Molecular Weight | 163.13 |
| CAS Registry Number | 98019-31-9 |
| SMILES | CCC(C([N+](=O)[O-])[N+](=O)[O-])N |
| InChI | 1S/C4H9N3O4/c1-2-3(5)4(6(8)9)7(10)11/h3-4H,2,5H2,1H3 |
| InChIKey | VWKKPWPCYFCOCX-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 241.7±30.0°C at 760 mmHg (Cal.) |
| Flash point | 100.0±24.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dinitro-2-butanamine |