Online Database of Chemicals from Around the World
|
CAS#: 98195-03-0 Product: Tris(Trimethylsilyl)-Methanethiol No suppilers available for the product. |
| Name | Tris(Trimethylsilyl)-Methanethiol |
|---|---|
| Synonyms | Methanethiol,Tris(Trimethylsilyl)-; Methanethiol, Tris(Trimethylsilyl)- |
| Molecular Structure |  |
| Molecular Formula | C10H28SSi3 |
| Molecular Weight | 264.65 |
| CAS Registry Number | 98195-03-0 |
| SMILES | C[Si](C([Si](C)(C)C)(S)[Si](C)(C)C)(C)C |
| InChI | 1S/C10H28SSi3/c1-12(2,3)10(11,13(4,5)6)14(7,8)9/h11H,1-9H3 |
| InChIKey | IBVDLFLORATGQR-UHFFFAOYSA-N |
| Density | 0.84g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.692°C at 760 mmHg (Cal.) |
| Flash point | 95.739°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(Trimethylsilyl)-Methanethiol |