| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Epsilon Chimie Chemical Manufacturer | France | |||
|---|---|---|---|---|
![]() |
+33 (2) 9842-4650 | |||
![]() |
pierre.cornec@epsilon-chimie.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Sarchem Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 708-1777 | |||
![]() |
sarchem@aol.com | |||
| Chemical manufacturer since 1984 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | 9H-Thioxanthene-3,6-Diamine, 10,10-Dioxide |
| Synonyms | (6-Amino-10,10-Diketo-9H-Thioxanthen-3-Yl)Amine; Oprea1_788127 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.31 |
| CAS Registry Number | 10215-25-5 |
| EINECS | 233-527-1 |
| SMILES | C1=C(N)C=CC3=C1[S](C2=CC(=CC=C2C3)N)(=O)=O |
| InChI | 1S/C13H12N2O2S/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)18(16,17)12(8)6-10/h1-4,6-7H,5,14-15H2 |
| InChIKey | UPVRZVIJGVFROW-UHFFFAOYSA-N |
| Density | 1.469g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.341°C at 760 mmHg (Cal.) |
| Flash point | 298.732°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |