Online Database of Chemicals from Around the World
| Name | 9-Propyl-beta-Carboline |
|---|---|
| Synonyms | 9-Propyl-$B-Carboline; 9-Propyl-Beta-Carboline; 9H-Pyrido(3,4-B)Indole, 9-Propyl- |
| Molecular Structure |  |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 |
| CAS Registry Number | 21373-41-1 |
| SMILES | C1=CC=CC2=C1[N](CCC)C3=C2C=CN=C3 |
| InChI | 1S/C14H14N2/c1-2-9-16-13-6-4-3-5-11(13)12-7-8-15-10-14(12)16/h3-8,10H,2,9H2,1H3 |
| InChIKey | VWQRAFOZXLPRGU-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.072°C at 760 mmHg (Cal.) |
| Flash point | 186.685°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Propyl-beta-Carboline |
