|
CAS#: 103970-75-8 Product: Quinconazole No suppilers available for the product. |
| Name | Quinconazole |
|---|---|
| Synonyms | 3-(2,4-Dichlorophenyl)-2-(1,2,4-Triazol-1-Yl)-4-Quinazolinone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9Cl2N5O |
| Molecular Weight | 358.19 |
| CAS Registry Number | 103970-75-8 |
| SMILES | C1=CC=CC2=C1C(N(C(=N2)[N]3N=CN=C3)C4=CC=C(C=C4Cl)Cl)=O |
| InChI | 1S/C16H9Cl2N5O/c17-10-5-6-14(12(18)7-10)23-15(24)11-3-1-2-4-13(11)21-16(23)22-9-19-8-20-22/h1-9H |
| InChIKey | OVFHHJZHXHZIHT-UHFFFAOYSA-N |
| Density | 1.573g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.447°C at 760 mmHg (Cal.) |
| Flash point | 324.801°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Quinconazole |