| Hefei TNJ Chemical Industry Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (551) 6541-8684 | |||
![]() |
sales@tnjchem.com | |||
| Chemical manufacturer since 2001 | ||||
| chemBlink massive supplier since 2021 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | Nopyl Acetate |
| Synonyms | Acetic Acid 2-(7,7-Dimethyl-4-Bicyclo[3.1.1]Hept-3-Enyl)Ethyl Ester; 2-(7,7-Dimethyl-4-Bicyclo[3.1.1]Hept-3-Enyl)Ethyl Ethanoate; Nsc 1286 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 128-51-8 |
| EINECS | 204-891-9 |
| SMILES | C(C1=CCC2C(C1C2)(C)C)COC(C)=O |
| InChI | 1S/C13H20O2/c1-9(14)15-7-6-10-4-5-11-8-12(10)13(11,2)3/h4,11-12H,5-8H2,1-3H3 |
| InChIKey | AWNOGHRWORTNEI-UHFFFAOYSA-N |
| Density | 0.997g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.842°C at 760 mmHg (Cal.) |
| Flash point | 100.734°C (Cal.) |
| Market Analysis Reports |