| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| OX CHEM | USA | |||
|---|---|---|---|---|
![]() |
+1 (626) 461-2812 | |||
![]() |
sales@ox-chem.com | |||
| CRO since 2013 | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4-(2-Chloro-1,1,2-Trifluoroethoxy)-2-Methylphenol |
|---|---|
| Synonyms | 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methylphenol; 4-(2-Chloro-1,1,2-Trifluoroethoxy)-2-Methyl-Phenol; Chlorotrifluoroethoxymethylphenol |
| Molecular Formula | C9H8ClF3O2 |
| Molecular Weight | 240.61 |
| CAS Registry Number | 129670-05-9 |
| SMILES | Cc1cc(OC(F)(F)C(Cl)F)ccc1O |
| InChI | 1S/C9H8ClF3O2/c1-5-4-6(2-3-7(5)14)15-9(12,13)8(10)11/h2-4,8,14H,1H3 |
| InChIKey | WBUZWDWYEGWODV-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.491°C at 760 mmHg (Cal.) |
| 83-84°C (Expl.) | |
| Flash point | 123.437°C (Cal.) |
| Refractive index | 1.485 (Cal.) |
| Market Analysis Reports |