Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Crescent Chemical Co. Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 348-0333 | |||
|
crescent@creschem.com | |||
| Chemical distributor | ||||
| Name | 5-Chloro-N-{1-[4-(Difluoromethoxy)Phenyl]Propyl}-6-Methyl-4-Pyrimidinamine |
|---|---|
| Synonyms | 4-Pyrimid |
| Molecular Structure | ![CAS#: 130339-07-0, 5-Chloro-N-{1-[4-(Difluoromethoxy)Phenyl]Propyl}-6-Methyl-4-Pyrimidinamine](/moreStructures/130339-07-0.gif) |
| Molecular Formula | C15H16ClF2N3O |
| Molecular Weight | 327.76 |
| CAS Registry Number | 130339-07-0 |
| SMILES | Clc2c(NC(CC)c1ccc(OC(F)F)cc1)ncnc2C |
| InChI | 1S/C15H16ClF2N3O/c1-3-12(21-14-13(16)9(2)19-8-20-14)10-4-6-11(7-5-10)22-15(17)18/h4-8,12,15H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | NEKULYKCZPJMMJ-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.796°C at 760 mmHg (Cal.) |
| Flash point | 214.943°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-N-{1-[4-(Difluoromethoxy)Phenyl]Propyl}-6-Methyl-4-Pyrimidinamine |