|
CAS#: 130349-18-7 Product: N-[(4-Aminophenyl)Methyl]-3-Chloropropanamide No suppilers available for the product. |
| Name | N-[(4-Aminophenyl)Methyl]-3-Chloropropanamide |
|---|---|
| Synonyms | N-[(4-Aminophenyl)Methyl]-3-Chloro-Propanamide; N-(4-Aminobenzyl)-3-Chloro-Propionamide; N-(4-Aminobenzyl)Beta-Chloropropionamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 |
| CAS Registry Number | 130349-18-7 |
| SMILES | C1=C(CNC(=O)CCCl)C=CC(=C1)N |
| InChI | 1S/C10H13ClN2O/c11-6-5-10(14)13-7-8-1-3-9(12)4-2-8/h1-4H,5-7,12H2,(H,13,14) |
| InChIKey | DWRMIFMQPYSJND-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.74°C at 760 mmHg (Cal.) |
| Flash point | 231.843°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(4-Aminophenyl)Methyl]-3-Chloropropanamide |