|
CAS#: 1403-56-1 Product: Fomecin A No suppilers available for the product. |
| Name | Fomecin A |
|---|---|
| Synonyms | 2,3,4-Trihydroxy-6-Methylol-Benzaldehyde; Benzaldehyde, 2,3,4-Trihydroxy-6-(Hydroxymethyl)-; Fomecin |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 |
| CAS Registry Number | 1403-56-1 |
| SMILES | C1=C(C(=C(C(=C1CO)C=O)O)O)O |
| InChI | 1S/C8H8O5/c9-2-4-1-6(11)8(13)7(12)5(4)3-10/h1,3,9,11-13H,2H2 |
| InChIKey | MGMUFSXXHCQPGA-UHFFFAOYSA-N |
| Density | 1.671g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.655°C at 760 mmHg (Cal.) |
| Flash point | 224.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fomecin A |