|
CAS#: 140438-62-6 Product: 2-Amino-9-[(3S,4S)-3,4-Dihydroxycyclopentyl]-3H-Purin-6-One No suppilers available for the product. |
| Name | 2-Amino-9-[(3S,4S)-3,4-Dihydroxycyclopentyl]-3H-Purin-6-One |
|---|---|
| Synonyms | 2-Amino-9-[(3S,4S)-3,4-Dihydroxycyclopentyl]-1,9-Dihydro-6H-Purin-6-One; Aids-189353; Aids189353 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.24 |
| CAS Registry Number | 140438-62-6 |
| SMILES | [N]2(C1=C(C(N=C(N1)N)=O)N=C2)C3C[C@@H]([C@H](C3)O)O |
| InChI | 1S/C10H13N5O3/c11-10-13-8-7(9(18)14-10)12-3-15(8)4-1-5(16)6(17)2-4/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t5-,6-/m0/s1 |
| InChIKey | LDYHQWURHCKRLK-WDSKDSINSA-N |
| Density | 2.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 627.831°C at 760 mmHg (Cal.) |
| Flash point | 333.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-9-[(3S,4S)-3,4-Dihydroxycyclopentyl]-3H-Purin-6-One |