|
CAS#: 1936-70-5 Product: Cycloprotobuxine C No suppilers available for the product. |
| Name | Cycloprotobuxine C |
|---|---|
| Synonyms | Cycloprotobuxine C; Nci60_000063; Alkaloid L |
| Molecular Structure | ![]() |
| Molecular Formula | C27H48N2 |
| Molecular Weight | 400.69 |
| CAS Registry Number | 1936-70-5 |
| SMILES | [C@]245[C@@]1([C@H](C(C)(C)[C@H](CC1)NC)CC[C@H]2[C@@]3(CC[C@@H]([C@]3(CC4)C)[C@@H](N(C)C)C)C)C5 |
| InChI | 1S/C27H48N2/c1-18(29(7)8)19-11-13-25(5)21-10-9-20-23(2,3)22(28-6)12-14-26(20)17-27(21,26)16-15-24(19,25)4/h18-22,28H,9-17H2,1-8H3/t18-,19+,20-,21-,22-,24+,25-,26+,27-/m0/s1 |
| InChIKey | PLKVWYPBRRRIQG-QGSMACLHSA-N |
| Density | 1.012g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.559°C at 760 mmHg (Cal.) |
| Flash point | 102.216°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cycloprotobuxine C |