Online Database of Chemicals from Around the World
|
CAS#: 196-77-0 Product: Indeno[1,7-ab]Pyrene No suppilers available for the product. |
| Name | Indeno[1,7-ab]Pyrene |
|---|---|
| Synonyms | Benzo(Def)Cyclopenta(Hi)Chrysene; Ccris 4312; Cyclopenta(Ij)Benzo(A)Pyrene |
| Molecular Structure | ![CAS#: 196-77-0, Indeno[1,7-ab]Pyrene](/moreStructures/196-77-0.gif) |
| Molecular Formula | C22H12 |
| Molecular Weight | 276.34 |
| CAS Registry Number | 196-77-0 |
| SMILES | C3=CC2=C6C1=C(C=CC=C1C5=C2C4=C(C=CC=C34)C=C5)C=C6 |
| InChI | 1S/C22H12/c1-3-13-7-11-18-16-6-2-5-15-9-10-17(21(15)16)19-12-8-14(4-1)20(13)22(18)19/h1-12H |
| InChIKey | KTUUKOLUMWVAQP-UHFFFAOYSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.32°C at 760 mmHg (Cal.) |
| Flash point | 265.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indeno[1,7-ab]Pyrene |