|
CAS#: 248-93-1 Product: 13H-Indeno(1,2-b)Anthracene No suppilers available for the product. |
| Name | 13H-Indeno(1,2-b)Anthracene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C21H14 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 248-93-1 |
| EINECS | 205-962-7 |
| SMILES | C2=C4C(=CC3=CC1=CC=CC=C1C=C23)CC5=C4C=CC=C5 |
| InChI | 1S/C21H14/c1-2-6-15-10-18-13-21-19(12-17(18)9-14(15)5-1)11-16-7-3-4-8-20(16)21/h1-10,12-13H,11H2 |
| InChIKey | WQIFERDZMYSWOI-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.653°C at 760 mmHg (Cal.) |
| Flash point | 242.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 13H-Indeno(1,2-b)Anthracene |