Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Acetryptine |
|---|---|
| Synonyms | 3-(2-Aminoethyl)Indol-5-Yl Methyl Ketone; Acetriptina [Inn-Spanish]; Acetryptin |
| Molecular Structure |  |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 |
| CAS Registry Number | 3551-18-6 |
| SMILES | C1=C(C(C)=O)C=CC2=C1C(=C[NH]2)CCN |
| InChI | 1S/C12H14N2O/c1-8(15)9-2-3-12-11(6-9)10(4-5-13)7-14-12/h2-3,6-7,14H,4-5,13H2,1H3 |
| InChIKey | RAUGYAOLAMRLLZ-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.345°C at 760 mmHg (Cal.) |
| Flash point | 202.575°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acetryptine |