|
CAS#: 4447-54-5 Product: Ethyl 2-Nitrohexanoate No suppilers available for the product. |
| Name | Ethyl 2-Nitrohexanoate |
|---|---|
| Synonyms | 2-Nitrohexanoic Acid Ethyl Ester; Nsc3649 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 4447-54-5 |
| SMILES | C(C(C(OCC)=O)[N+](=O)[O-])CCC |
| InChI | 1S/C8H15NO4/c1-3-5-6-7(9(11)12)8(10)13-4-2/h7H,3-6H2,1-2H3 |
| InChIKey | BOMJMFPCSAPKAO-UHFFFAOYSA-N |
| Density | 1.068g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.336°C at 760 mmHg (Cal.) |
| Flash point | 96.046°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-Nitrohexanoate |