|
CAS#: 4825-87-0 Product: Ochratoxin A-O-Methyl, Methyl Ester No suppilers available for the product. |
| Name | Ochratoxin A-O-Methyl, Methyl Ester |
|---|---|
| Synonyms | Methyl (2S)-2-[[(3R)-5-Chloro-8-Methoxy-3-Methyl-1-Oxo-Isochroman-7-Carbonyl]Amino]-3-Phenyl-Propanoate; (2S)-2-[[[(3R)-5-Chloro-8-Methoxy-3-Methyl-1-Oxo-7-Isochromanyl]-Oxomethyl]Amino]-3-Phenylpropanoic Acid Methyl Ester; (2S)-2-[[(3R)-5-Chloro-1-Keto-8-Methoxy-3-Methyl-Isochroman-7-Carbonyl]Amino]-3-Phenyl-Propionic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22ClNO6 |
| Molecular Weight | 431.87 |
| CAS Registry Number | 4825-87-0 |
| SMILES | [C@H](C(=O)OC)(NC(=O)C2=CC(=C1C[C@H](OC(C1=C2OC)=O)C)Cl)CC3=CC=CC=C3 |
| InChI | 1S/C22H22ClNO6/c1-12-9-14-16(23)11-15(19(28-2)18(14)22(27)30-12)20(25)24-17(21(26)29-3)10-13-7-5-4-6-8-13/h4-8,11-12,17H,9-10H2,1-3H3,(H,24,25)/t12-,17+/m1/s1 |
| InChIKey | RCTSSFFIVYPOQC-PXAZEXFGSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 609.761°C at 760 mmHg (Cal.) |
| Flash point | 322.572°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ochratoxin A-O-Methyl, Methyl Ester |