|
CAS#: 50439-68-4 Product: Dihydrocorynantheine No suppilers available for the product. |
| Name | Dihydrocorynantheine |
|---|---|
| Synonyms | Methyl (E)-2-[(2S,3R,12Bs)-3-Ethyl-1,2,3,4,6,7,12,12B-Octahydroindolo[3,2-H]Quinolizin-2-Yl]-3-Methoxy-Prop-2-Enoate; (E)-2-[(2S,3R,12Bs)-3-Ethyl-1,2,3,4,6,7,12,12B-Octahydroindolo[3,2-H]Quinolizin-2-Yl]-3-Methoxyprop-2-Enoic Acid Methyl Ester; (E)-2-[(2S,3R,12Bs)-3-Ethyl-1,2,3,4,6,7,12,12B-Octahydropyrido[2,1-A]$B-Carbolin-2-Yl]-3-Methoxy-Acrylic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.47 |
| CAS Registry Number | 50439-68-4 |
| SMILES | [C@H]34C1=C(C2=C([NH]1)C=CC=C2)CCN3C[C@@H]([C@@H](\C(C(=O)OC)=C/OC)C4)CC |
| InChI | 1S/C22H28N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h5-8,13-14,17,20,23H,4,9-12H2,1-3H3/b18-13+/t14-,17-,20-/m0/s1 |
| InChIKey | NMLUOJBSAYAYEM-XPOGPMDLSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.709°C at 760 mmHg (Cal.) |
| Flash point | 275.368°C (Cal.) |
| (1) | Merlini L. Gambirine, a new indole alkaloid from ? ? roxb., Tetrahedron Letters, 1967 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dihydrocorynantheine |