Online Database of Chemicals from Around the World
|
CAS#: 53172-79-5 Product: 9-Bromo-2-Nitrofluorene No suppilers available for the product. |
| Name | 9-Bromo-2-Nitrofluorene |
|---|---|
| Synonyms | Nsc12355; Fluorene, 9-Bromo-2-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C13H8BrNO2 |
| Molecular Weight | 290.12 |
| CAS Registry Number | 53172-79-5 |
| SMILES | C3=C2C1=C(C=CC=C1)C(C2=CC(=C3)[N+](=O)[O-])Br |
| InChI | 1S/C13H8BrNO2/c14-13-11-4-2-1-3-9(11)10-6-5-8(15(16)17)7-12(10)13/h1-7,13H |
| InChIKey | MQMLOKJKGOPCKW-UHFFFAOYSA-N |
| Density | 1.662g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.969°C at 760 mmHg (Cal.) |
| Flash point | 192.066°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 9-Bromo-2-Nitrofluorene |