|
CAS#: 60070-14-6 Product: Mariptiline No suppilers available for the product. |
| Name | Mariptiline |
|---|---|
| Synonyms | Mariptilina; Mariptiline; Mariptiline [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 |
| CAS Registry Number | 60070-14-6 |
| SMILES | C1=CC=CC\3=C1C4C(C2=C(C=CC=C2)C3=N\OCCN)C4 |
| InChI | 1S/C18H18N2O/c19-9-10-21-20-18-14-7-3-1-5-12(14)16-11-17(16)13-6-2-4-8-15(13)18/h1-8,16-17H,9-11,19H2 |
| InChIKey | ZJUNTBVPKYZTPD-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.63°C at 760 mmHg (Cal.) |
| Flash point | 196.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mariptiline |