|
CAS#: 6025-45-2 Product: Disodium Benzene-1,3-Diolate No suppilers available for the product. |
| Name | Disodium Benzene-1,3-Diolate |
|---|---|
| Synonyms | 1,3-Benzenediol, Disodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4Na2O2 |
| Molecular Weight | 154.08 |
| CAS Registry Number | 6025-45-2 |
| SMILES | C1=C([O-])C=CC=C1[O-].[Na+].[Na+] |
| InChI | 1S/C6H6O2.2Na/c7-5-2-1-3-6(8)4-5;;/h1-4,7-8H;;/q;2*+1/p-2 |
| InChIKey | CHBGPSMCICHVTB-UHFFFAOYSA-L |
| Boiling point | 280°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium Benzene-1,3-Diolate |