Online Database of Chemicals from Around the World
|
CAS#: 6065-16-3 Product: 3-Nitro-2-Hexene No suppilers available for the product. |
| Name | 3-Nitro-2-Hexene |
|---|---|
| Synonyms | 4-01-00-00836 (Beilstein Handbook Reference); Brn 1702338; 2-Hexene, 3-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 |
| CAS Registry Number | 6065-16-3 |
| SMILES | C(\C([N+]([O-])=O)=C\C)CC |
| InChI | 1S/C6H11NO2/c1-3-5-6(4-2)7(8)9/h4H,3,5H2,1-2H3/b6-4- |
| InChIKey | CEHMJHORJSNKTM-XQRVVYSFSA-N |
| Density | 0.966g/cm3 (Cal.) |
|---|---|
| Boiling point | 188.25°C at 760 mmHg (Cal.) |
| Flash point | 65.615°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-2-Hexene |