|
CAS#: 625-89-8 Product: N-Nitrosobis(2,2,2-Trifluoroethyl)Amine No suppilers available for the product. |
| Name | N-Nitrosobis(2,2,2-Trifluoroethyl)Amine |
|---|---|
| Synonyms | 2,2,2-Trifluoro-N-Nitroso-N-(2,2,2-Trifluoroethyl)Ethanamine; N-Nitrosobis(2,2,2-Trifluoroethyl) Amine; 6-F-Den |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4F6N2O |
| Molecular Weight | 210.08 |
| CAS Registry Number | 625-89-8 |
| SMILES | C(N(N=O)CC(F)(F)F)C(F)(F)F |
| InChI | 1S/C4H4F6N2O/c5-3(6,7)1-12(11-13)2-4(8,9)10/h1-2H2 |
| InChIKey | YUEXLPFBTMPXCY-UHFFFAOYSA-N |
| Density | 1.523g/cm3 (Cal.) |
|---|---|
| Boiling point | 138.965°C at 760 mmHg (Cal.) |
| Flash point | 37.845°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Nitrosobis(2,2,2-Trifluoroethyl)Amine |